C13H22F2O5S — CID 89310069
2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 89310069) has the molecular formula C13H22F2O5S and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 89310069 |
| Molecular Formula | C13H22F2O5S |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC(C)=CC(C)(C(=O)OCC(F)(F)S(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H22F2O5S/c1-9(2)7-12(6,11(3,4)5)10(16)20-8-13(14,15)21(17,18)19/h7H,8H2,1-6H3,(H,17,18,19) |
| InChIKey | OOUBIOOKJPFRJW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|