C13H24O3 — CID 87664251
2-hydroxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate (PubChem CID 87664251) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-hydroxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate.
| Compound Name | 2-hydroxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 87664251 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-hydroxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate |
| SMILES | CC(C)=CC(C)(C(=O)OCCO)C(C)(C)C |
| InChI | InChI=1S/C13H24O3/c1-10(2)9-13(6,12(3,4)5)11(15)16-8-7-14/h9,14H,7-8H2,1-6H3 |
| InChIKey | VQPDZMBTJLJBET-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|