C16H28O3 — CID 89235047
2-prop-2-enoxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate (PubChem CID 89235047) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-prop-2-enoxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate.
| Compound Name | 2-prop-2-enoxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 89235047 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-prop-2-enoxyethyl 2-tert-butyl-2,4-dimethylpent-3-enoate |
| SMILES | C=CCOCCOC(=O)C(C)(C=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3/c1-8-9-18-10-11-19-14(17)16(7,12-13(2)3)15(4,5)6/h8,12H,1,9-11H2,2-7H3 |
| InChIKey | HAIKRIITTSGGCE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|