C13H25NO — CID 88877368
2-tert-butyl-N,N,2,4-tetramethylpent-3-enamide (PubChem CID 88877368) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-tert-butyl-N,N,2,4-tetramethylpent-3-enamide.
| Compound Name | 2-tert-butyl-N,N,2,4-tetramethylpent-3-enamide |
|---|---|
| PubChem CID | 88877368 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2-tert-butyl-N,N,2,4-tetramethylpent-3-enamide |
| SMILES | CC(C)=CC(C)(C(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-10(2)9-13(6,12(3,4)5)11(15)14(7)8/h9H,1-8H3 |
| InChIKey | HYZKVJUZMMMVIC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|