C13H24O5S — CID 89046420
2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid (PubChem CID 89046420) has the molecular formula C13H24O5S and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid.
| Compound Name | 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 89046420 |
| Molecular Formula | C13H24O5S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid |
| SMILES | CC(C)=CC(C)(C(=O)OCCS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H24O5S/c1-10(2)9-13(6,12(3,4)5)11(14)18-7-8-19(15,16)17/h9H,7-8H2,1-6H3,(H,15,16,17) |
| InChIKey | YFCMIQHFPPUFPX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|