About 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid
2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid (PubChem CID 89046420) has the molecular formula C13H24O5S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid.
Molecular Properties
| Compound Name | 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid |
| PubChem CID | 89046420 |
| Molecular Formula | C13H24O5S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid |
| SMILES | CC(C)=CC(C)(C(=O)OCCS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H24O5S/c1-10(2)9-13(6,12(3,4)5)11(14)18-7-8-19(15,16)17/h9H,7-8H2,1-6H3,(H,15,16,17) |
| InChIKey | YFCMIQHFPPUFPX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid?
The IUPAC name of 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid (CID 89046420) is 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid.
What is the SMILES notation for 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid?
The canonical SMILES for 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid is CC(C)=CC(C)(C(=O)OCCS(=O)(=O)O)C(C)(C)C.
What is the InChIKey of 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid?
The InChIKey is YFCMIQHFPPUFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O5S/c1-10(2)9-13(6,12(3,4)5)11(14)18-7-8-19(15,16)17/h9H,7-8H2,1-6H3,(H,15,16,17).
What are the key properties of 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid?
2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid has a molecular weight of 292.40 g/mol, XLogP of 2.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxyethanesulfonic acid is sourced from PubChem (CID 89046420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).