C17H23F9O2 — CID 88902065
3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-tert-butyl-2,4-dimethylpent-3-enoate (PubChem CID 88902065) has the molecular formula C17H23F9O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-tert-butyl-2,4-dimethylpent-3-enoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-tert-butyl-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 88902065 |
| Molecular Formula | C17H23F9O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-tert-butyl-2,4-dimethylpent-3-enoate |
| SMILES | CC(C)=CC(C)(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C17H23F9O2/c1-10(2)9-13(6,12(3,4)5)11(27)28-8-7-14(18,19)15(20,21)16(22,23)17(24,25)26/h9H,7-8H2,1-6H3 |
| InChIKey | SZIMHOUGPUTGLM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|