C17H33NO — CID 89122831
2-tert-butyl-2,4-dimethyl-N,N-di(propan-2-yl)pent-3-enamide (PubChem CID 89122831) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 2-tert-butyl-2,4-dimethyl-N,N-di(propan-2-yl)pent-3-enamide.
| Compound Name | 2-tert-butyl-2,4-dimethyl-N,N-di(propan-2-yl)pent-3-enamide |
|---|---|
| PubChem CID | 89122831 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 2-tert-butyl-2,4-dimethyl-N,N-di(propan-2-yl)pent-3-enamide |
| SMILES | CC(C)=CC(C)(C(=O)N(C(C)C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO/c1-12(2)11-17(10,16(7,8)9)15(19)18(13(3)4)14(5)6/h11,13-14H,1-10H3 |
| InChIKey | XUODAPKMKFLTON-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|