C14H29NO — CID 58799213
2,2,3,3-tetramethyl-N,N-di(propan-2-yl)butanamide (PubChem CID 58799213) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N,N-di(propan-2-yl)butanamide.
| Compound Name | 2,2,3,3-tetramethyl-N,N-di(propan-2-yl)butanamide |
|---|---|
| PubChem CID | 58799213 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2,2,3,3-tetramethyl-N,N-di(propan-2-yl)butanamide |
| SMILES | CC(C)N(C(=O)C(C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H29NO/c1-10(2)15(11(3)4)12(16)14(8,9)13(5,6)7/h10-11H,1-9H3 |
| InChIKey | ROFLSRSYHLXQKX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |