About 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea
3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea (PubChem CID 169174386) has the molecular formula C11H23FN2O2S
and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea |
| PubChem CID | 169174386 |
| Molecular Formula | C11H23FN2O2S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)N=[S@](=O)(F)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C11H23FN2O2S/c1-8(2)14(9(3)4)10(15)13-17(12,16)11(5,6)7/h8-9H,1-7H3/t17-/m1/s1 |
| InChIKey | ZDAOBEFNHRJWST-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
The IUPAC name of 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea (CID 169174386) is 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea.
What is the SMILES notation for 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
The canonical SMILES for 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea is CC(C)N(C(=O)N=[S@](=O)(F)C(C)(C)C)C(C)C.
What is the InChIKey of 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
The InChIKey is ZDAOBEFNHRJWST-QGZVFWFLSA-N. The full InChI is InChI=1S/C11H23FN2O2S/c1-8(2)14(9(3)4)10(15)13-17(12,16)11(5,6)7/h8-9H,1-7H3/t17-/m1/s1.
What are the key properties of 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea?
3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea has a molecular weight of 266.38 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(tert-butyl-fluoro-oxo-λ6-sulfanylidene)-1,1-di(propan-2-yl)urea is sourced from PubChem (CID 169174386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).