C7H14ClNOS — CID 20975381
S-chloro N,N-di(propan-2-yl)carbamothioate (PubChem CID 20975381) has the molecular formula C7H14ClNOS and a molecular weight of 195.71 g/mol. Its IUPAC name is S-chloro N,N-di(propan-2-yl)carbamothioate.
| Compound Name | S-chloro N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 20975381 |
| Molecular Formula | C7H14ClNOS |
| Molecular Weight | 195.71 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | S-chloro N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)SCl)C(C)C |
| InChI | InChI=1S/C7H14ClNOS/c1-5(2)9(6(3)4)7(10)11-8/h5-6H,1-4H3 |
| InChIKey | DCHJKSZRQBWRHS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|