C11H22ClNOS — CID 88699435
S-(4-chlorobutyl) N,N-di(propan-2-yl)carbamothioate (PubChem CID 88699435) has the molecular formula C11H22ClNOS and a molecular weight of 251.82 g/mol. Its IUPAC name is S-(4-chlorobutyl) N,N-di(propan-2-yl)carbamothioate.
| Compound Name | S-(4-chlorobutyl) N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 88699435 |
| Molecular Formula | C11H22ClNOS |
| Molecular Weight | 251.82 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | S-(4-chlorobutyl) N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)SCCCCCl)C(C)C |
| InChI | InChI=1S/C11H22ClNOS/c1-9(2)13(10(3)4)11(14)15-8-6-5-7-12/h9-10H,5-8H2,1-4H3 |
| InChIKey | JJLQKTRZLGAXMQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|