C20H37Cl3N2O2S2 — CID 87387686
S-propyl N,N-dipropylcarbamothioate;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate (PubChem CID 87387686) has the molecular formula C20H37Cl3N2O2S2 and a molecular weight of 508.02 g/mol. Its IUPAC name is S-propyl N,N-dipropylcarbamothioate;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate.
| Compound Name | S-propyl N,N-dipropylcarbamothioate;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 87387686 |
| Molecular Formula | C20H37Cl3N2O2S2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | S-propyl N,N-dipropylcarbamothioate;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)SCC(Cl)=C(Cl)Cl)C(C)C.CCCSC(=O)N(CCC)CCC |
| InChI | InChI=1S/C10H16Cl3NOS.C10H21NOS/c1-6(2)14(7(3)4)10(15)16-5-8(11)9(12)13;1-4-7-11(8-5-2)10(12)13-9-6-3/h6-7H,5H2,1-4H3;4-9H2,1-3H3 |
| InChIKey | GCIUMZPLPVBBAY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|