C19H38N2O2S2 — CID 71326230
2-[3-[2-(dipropylamino)-2-oxoethyl]sulfanylpropylsulfanyl]-N,N-dipropylacetamide (PubChem CID 71326230) has the molecular formula C19H38N2O2S2 and a molecular weight of 390.66 g/mol. Its IUPAC name is 2-[3-[2-(dipropylamino)-2-oxoethyl]sulfanylpropylsulfanyl]-N,N-dipropylacetamide.
| Compound Name | 2-[3-[2-(dipropylamino)-2-oxoethyl]sulfanylpropylsulfanyl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 71326230 |
| Molecular Formula | C19H38N2O2S2 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[3-[2-(dipropylamino)-2-oxoethyl]sulfanylpropylsulfanyl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CSCCCSCC(=O)N(CCC)CCC |
| InChI | InChI=1S/C19H38N2O2S2/c1-5-10-20(11-6-2)18(22)16-24-14-9-15-25-17-19(23)21(12-7-3)13-8-4/h5-17H2,1-4H3 |
| InChIKey | JKCWGVWKYLXSBO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|