C10H21NOS — CID 12528633
2-butylsulfanyl-N,N-diethylacetamide (PubChem CID 12528633) has the molecular formula C10H21NOS and a molecular weight of 203.35 g/mol. Its IUPAC name is 2-butylsulfanyl-N,N-diethylacetamide.
| Compound Name | 2-butylsulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 12528633 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-butylsulfanyl-N,N-diethylacetamide |
| SMILES | CCCCSCC(=O)N(CC)CC |
| InChI | InChI=1S/C10H21NOS/c1-4-7-8-13-9-10(12)11(5-2)6-3/h4-9H2,1-3H3 |
| InChIKey | CFUGVTRXGXUCLK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|