C10H21NO3S — CID 61236004
2-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 61236004) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide.
| Compound Name | 2-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 61236004 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | CCCCSCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H21NO3S/c1-2-3-8-15-9-10(14)11(4-6-12)5-7-13/h12-13H,2-9H2,1H3 |
| InChIKey | PTUXQAXZNIHHNQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|