C9H18N2O2S — CID 60734352
3-(2-amino-2-oxoethyl)sulfanyl-N,N-diethylpropanamide (PubChem CID 60734352) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N,N-diethylpropanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60734352 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCSCC(N)=O |
| InChI | InChI=1S/C9H18N2O2S/c1-3-11(4-2)9(13)5-6-14-7-8(10)12/h3-7H2,1-2H3,(H2,10,12) |
| InChIKey | AAPSGWXCUQRZHS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|