C16H30N2O5S — CID 169015752
2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-propanoyloxyethyl)amino]ethyl propanoate (PubChem CID 169015752) has the molecular formula C16H30N2O5S and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-propanoyloxyethyl)amino]ethyl propanoate.
| Compound Name | 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-propanoyloxyethyl)amino]ethyl propanoate |
|---|---|
| PubChem CID | 169015752 |
| Molecular Formula | C16H30N2O5S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-propanoyloxyethyl)amino]ethyl propanoate |
| SMILES | CCC(=O)OCCN(CCOC(=O)CC)C(=O)CSCCN(C)C |
| InChI | InChI=1S/C16H30N2O5S/c1-5-15(20)22-10-7-18(8-11-23-16(21)6-2)14(19)13-24-12-9-17(3)4/h5-13H2,1-4H3 |
| InChIKey | TYSNADVQDCJIRP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|