About 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium
2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium (PubChem CID 169015750) has the molecular formula C12H20NO5Y-
and a molecular weight of 347.20 g/mol. Its IUPAC name is 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium.
Molecular Properties
| Compound Name | 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium |
| PubChem CID | 169015750 |
| Molecular Formula | C12H20NO5Y- |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium |
| SMILES | [CH2-]C(=O)N(CCOC(=O)CC)CCOC(=O)CC.[Y] |
| InChI | InChI=1S/C12H20NO5.Y/c1-4-11(15)17-8-6-13(10(3)14)7-9-18-12(16)5-2;/h3-9H2,1-2H3;/q-1; |
| InChIKey | SMNYLLPETPPKEJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium?
The IUPAC name of 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium (CID 169015750) is 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium.
What is the SMILES notation for 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium?
The canonical SMILES for 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium is [CH2-]C(=O)N(CCOC(=O)CC)CCOC(=O)CC.[Y].
What is the InChIKey of 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium?
The InChIKey is SMNYLLPETPPKEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20NO5.Y/c1-4-11(15)17-8-6-13(10(3)14)7-9-18-12(16)5-2;/h3-9H2,1-2H3;/q-1;.
What are the key properties of 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium?
2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium has a molecular weight of 347.20 g/mol, XLogP of 0.55, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[acetyl(2-propanoyloxyethyl)amino]ethyl propanoate;yttrium is sourced from PubChem (CID 169015750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).