About 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane
2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane (PubChem CID 142272476) has the molecular formula C16H37NO4
and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane.
Molecular Properties
| Compound Name | 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane |
| PubChem CID | 142272476 |
| Molecular Formula | C16H37NO4 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.27 |
| IUPAC Name | 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane |
| SMILES | CC.CC.CC.CCC(=O)OCCN(C)CCOC(C)=O |
| InChI | InChI=1S/C10H19NO4.3C2H6/c1-4-10(13)15-8-6-11(3)5-7-14-9(2)12;3*1-2/h4-8H2,1-3H3;3*1-2H3 |
| InChIKey | PFTVLNGJFVWBOH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane?
The IUPAC name of 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane (CID 142272476) is 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane.
What is the SMILES notation for 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane?
The canonical SMILES for 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane is CC.CC.CC.CCC(=O)OCCN(C)CCOC(C)=O.
What is the InChIKey of 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane?
The InChIKey is PFTVLNGJFVWBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4.3C2H6/c1-4-10(13)15-8-6-11(3)5-7-14-9(2)12;3*1-2/h4-8H2,1-3H3;3*1-2H3.
What are the key properties of 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane?
2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane has a molecular weight of 307.48 g/mol, XLogP of 3.51, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-acetyloxyethyl(methyl)amino]ethyl propanoate;ethane is sourced from PubChem (CID 142272476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).