About butyl acetate;butyl propanoate
butyl acetate;butyl propanoate (PubChem CID 146454532) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is butyl acetate;butyl propanoate.
Molecular Properties
| Compound Name | butyl acetate;butyl propanoate |
| PubChem CID | 146454532 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | butyl acetate;butyl propanoate |
| SMILES | CCCCOC(=O)CC.CCCCOC(C)=O |
| InChI | InChI=1S/C7H14O2.C6H12O2/c1-3-5-6-9-7(8)4-2;1-3-4-5-8-6(2)7/h3-6H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | MCHVZSFRDINGGF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl acetate;butyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl acetate;butyl propanoate?
The IUPAC name of butyl acetate;butyl propanoate (CID 146454532) is butyl acetate;butyl propanoate.
What is the SMILES notation for butyl acetate;butyl propanoate?
The canonical SMILES for butyl acetate;butyl propanoate is CCCCOC(=O)CC.CCCCOC(C)=O.
What is the InChIKey of butyl acetate;butyl propanoate?
The InChIKey is MCHVZSFRDINGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C6H12O2/c1-3-5-6-9-7(8)4-2;1-3-4-5-8-6(2)7/h3-6H2,1-2H3;3-5H2,1-2H3.
What are the key properties of butyl acetate;butyl propanoate?
butyl acetate;butyl propanoate has a molecular weight of 246.35 g/mol, XLogP of 3.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl acetate;butyl propanoate is sourced from PubChem (CID 146454532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).