C8H12Cl6O2 — CID 175016872
butyl acetate;1,1,1,2,2,2-hexachloroethane (PubChem CID 175016872) has the molecular formula C8H12Cl6O2 and a molecular weight of 352.90 g/mol. Its IUPAC name is butyl acetate;1,1,1,2,2,2-hexachloroethane.
| Compound Name | butyl acetate;1,1,1,2,2,2-hexachloroethane |
|---|---|
| PubChem CID | 175016872 |
| Molecular Formula | C8H12Cl6O2 |
| Molecular Weight | 352.90 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | butyl acetate;1,1,1,2,2,2-hexachloroethane |
| SMILES | CCCCOC(C)=O.ClC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H12O2.C2Cl6/c1-3-4-5-8-6(2)7;3-1(4,5)2(6,7)8/h3-5H2,1-2H3; |
| InChIKey | MAPFVUVCRSGEES-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.90 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|