About 2-(dimethylamino)ethyl 4-oxopentanoate
2-(dimethylamino)ethyl 4-oxopentanoate (PubChem CID 21027209) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-oxopentanoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 4-oxopentanoate |
| PubChem CID | 21027209 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCCN(C)C |
| InChI | InChI=1S/C9H17NO3/c1-8(11)4-5-9(12)13-7-6-10(2)3/h4-7H2,1-3H3 |
| InChIKey | OJRMYVJVWJSOSS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)ethyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 4-oxopentanoate?
The IUPAC name of 2-(dimethylamino)ethyl 4-oxopentanoate (CID 21027209) is 2-(dimethylamino)ethyl 4-oxopentanoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 4-oxopentanoate?
The canonical SMILES for 2-(dimethylamino)ethyl 4-oxopentanoate is CC(=O)CCC(=O)OCCN(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl 4-oxopentanoate?
The InChIKey is OJRMYVJVWJSOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-8(11)4-5-9(12)13-7-6-10(2)3/h4-7H2,1-3H3.
What are the key properties of 2-(dimethylamino)ethyl 4-oxopentanoate?
2-(dimethylamino)ethyl 4-oxopentanoate has a molecular weight of 187.24 g/mol, XLogP of 0.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 4-oxopentanoate is sourced from PubChem (CID 21027209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).