About 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate
2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate (PubChem CID 118689097) has the molecular formula C18H32N2O6
and a molecular weight of 372.46 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate.
Molecular Properties
| Compound Name | 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate |
| PubChem CID | 118689097 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate |
| SMILES | CCN(CC)C(=O)CCC(=O)N(CCOC)CCOC(=O)CCC(C)=O |
| InChI | InChI=1S/C18H32N2O6/c1-5-19(6-2)16(22)8-9-17(23)20(11-13-25-4)12-14-26-18(24)10-7-15(3)21/h5-14H2,1-4H3 |
| InChIKey | GYRTXWSNXDUVTJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate?
The IUPAC name of 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate (CID 118689097) is 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate.
What is the SMILES notation for 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate?
The canonical SMILES for 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate is CCN(CC)C(=O)CCC(=O)N(CCOC)CCOC(=O)CCC(C)=O.
What is the InChIKey of 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate?
The InChIKey is GYRTXWSNXDUVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O6/c1-5-19(6-2)16(22)8-9-17(23)20(11-13-25-4)12-14-26-18(24)10-7-15(3)21/h5-14H2,1-4H3.
What are the key properties of 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate?
2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate has a molecular weight of 372.46 g/mol, XLogP of 1.02, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(diethylamino)-4-oxobutanoyl]-(2-methoxyethyl)amino]ethyl 4-oxopentanoate is sourced from PubChem (CID 118689097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).