About 6-methoxyhexyl 4-oxopentanoate
6-methoxyhexyl 4-oxopentanoate (PubChem CID 89458517) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 6-methoxyhexyl 4-oxopentanoate.
Molecular Properties
| Compound Name | 6-methoxyhexyl 4-oxopentanoate |
| PubChem CID | 89458517 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-methoxyhexyl 4-oxopentanoate |
| SMILES | COCCCCCCOC(=O)CCC(C)=O |
| InChI | InChI=1S/C12H22O4/c1-11(13)7-8-12(14)16-10-6-4-3-5-9-15-2/h3-10H2,1-2H3 |
| InChIKey | VDGJHAKUKDEKRB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxyhexyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyhexyl 4-oxopentanoate?
The IUPAC name of 6-methoxyhexyl 4-oxopentanoate (CID 89458517) is 6-methoxyhexyl 4-oxopentanoate.
What is the SMILES notation for 6-methoxyhexyl 4-oxopentanoate?
The canonical SMILES for 6-methoxyhexyl 4-oxopentanoate is COCCCCCCOC(=O)CCC(C)=O.
What is the InChIKey of 6-methoxyhexyl 4-oxopentanoate?
The InChIKey is VDGJHAKUKDEKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-11(13)7-8-12(14)16-10-6-4-3-5-9-15-2/h3-10H2,1-2H3.
What are the key properties of 6-methoxyhexyl 4-oxopentanoate?
6-methoxyhexyl 4-oxopentanoate has a molecular weight of 230.30 g/mol, XLogP of 2.11, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyhexyl 4-oxopentanoate is sourced from PubChem (CID 89458517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).