C18H34O10 — CID 159514467
butanedioic acid;butane-1,4-diol;4-methoxybutyl 4-oxopentanoate (PubChem CID 159514467) has the molecular formula C18H34O10 and a molecular weight of 410.46 g/mol. Its IUPAC name is butanedioic acid;butane-1,4-diol;4-methoxybutyl 4-oxopentanoate.
| Compound Name | butanedioic acid;butane-1,4-diol;4-methoxybutyl 4-oxopentanoate |
|---|---|
| PubChem CID | 159514467 |
| Molecular Formula | C18H34O10 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | butanedioic acid;butane-1,4-diol;4-methoxybutyl 4-oxopentanoate |
| SMILES | COCCCCOC(=O)CCC(C)=O.O=C(O)CCC(=O)O.OCCCCO |
| InChI | InChI=1S/C10H18O4.C4H6O4.C4H10O2/c1-9(11)5-6-10(12)14-8-4-3-7-13-2;5-3(6)1-2-4(7)8;5-3-1-2-4-6/h3-8H2,1-2H3;1-2H2,(H,5,6)(H,7,8);5-6H,1-4H2 |
| InChIKey | MAZWAIWSTDRNFB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|