C13H21NO7 — CID 142491942
4-[2-[2-methoxyethyl(4-oxobutanoyl)amino]ethoxy]-4-oxobutanoic acid (PubChem CID 142491942) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-[2-[2-methoxyethyl(4-oxobutanoyl)amino]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-methoxyethyl(4-oxobutanoyl)amino]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142491942 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[2-[2-methoxyethyl(4-oxobutanoyl)amino]ethoxy]-4-oxobutanoic acid |
| SMILES | COCCN(CCOC(=O)CCC(=O)O)C(=O)CCC=O |
| InChI | InChI=1S/C13H21NO7/c1-20-9-6-14(11(16)3-2-8-15)7-10-21-13(19)5-4-12(17)18/h8H,2-7,9-10H2,1H3,(H,17,18) |
| InChIKey | WUQSLGJZALXZPB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|