C11H16O7 — CID 58884340
4-oxo-4-[3-(4-oxobutanoyloxy)propoxy]butanoic acid (PubChem CID 58884340) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is 4-oxo-4-[3-(4-oxobutanoyloxy)propoxy]butanoic acid.
| Compound Name | 4-oxo-4-[3-(4-oxobutanoyloxy)propoxy]butanoic acid |
|---|---|
| PubChem CID | 58884340 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-oxo-4-[3-(4-oxobutanoyloxy)propoxy]butanoic acid |
| SMILES | O=CCCC(=O)OCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H16O7/c12-6-1-3-10(15)17-7-2-8-18-11(16)5-4-9(13)14/h6H,1-5,7-8H2,(H,13,14) |
| InChIKey | LHXVLVRWSTWISG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|