About 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate
2-[ethyl(methyl)amino]ethyl 4-oxobutanoate (PubChem CID 138517568) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate.
Molecular Properties
| Compound Name | 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate |
| PubChem CID | 138517568 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate |
| SMILES | CCN(C)CCOC(=O)CCC=O |
| InChI | InChI=1S/C9H17NO3/c1-3-10(2)6-8-13-9(12)5-4-7-11/h7H,3-6,8H2,1-2H3 |
| InChIKey | VXGOTALLRWGMPH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate?
The IUPAC name of 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate (CID 138517568) is 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate.
What is the SMILES notation for 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate?
The canonical SMILES for 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate is CCN(C)CCOC(=O)CCC=O.
What is the InChIKey of 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate?
The InChIKey is VXGOTALLRWGMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-10(2)6-8-13-9(12)5-4-7-11/h7H,3-6,8H2,1-2H3.
What are the key properties of 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate?
2-[ethyl(methyl)amino]ethyl 4-oxobutanoate has a molecular weight of 187.24 g/mol, XLogP of 0.46, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(methyl)amino]ethyl 4-oxobutanoate is sourced from PubChem (CID 138517568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).