C18H27NO12 — CID 59383186
4-[2-[bis[2-(3-carboxypropanoyloxy)ethyl]amino]ethoxy]-4-oxobutanoic acid (PubChem CID 59383186) has the molecular formula C18H27NO12 and a molecular weight of 449.41 g/mol. Its IUPAC name is 4-[2-[bis[2-(3-carboxypropanoyloxy)ethyl]amino]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[bis[2-(3-carboxypropanoyloxy)ethyl]amino]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59383186 |
| Molecular Formula | C18H27NO12 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-[2-[bis[2-(3-carboxypropanoyloxy)ethyl]amino]ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCN(CCOC(=O)CCC(=O)O)CCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C18H27NO12/c20-13(21)1-4-16(26)29-10-7-19(8-11-30-17(27)5-2-14(22)23)9-12-31-18(28)6-3-15(24)25/h1-12H2,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | MMBSKOGWNJMVSO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|