C11H24N2O — CID 17217773
3-butan-2-yl-1,1-dipropylurea (PubChem CID 17217773) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-butan-2-yl-1,1-dipropylurea.
| Compound Name | 3-butan-2-yl-1,1-dipropylurea |
|---|---|
| PubChem CID | 17217773 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3-butan-2-yl-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NC(C)CC |
| InChI | InChI=1S/C11H24N2O/c1-5-8-13(9-6-2)11(14)12-10(4)7-3/h10H,5-9H2,1-4H3,(H,12,14) |
| InChIKey | VYVSMUCIHZTSJP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |