C7H15IN2O — CID 87969845
3-iodo-1,1-dipropylurea (PubChem CID 87969845) has the molecular formula C7H15IN2O and a molecular weight of 270.11 g/mol. Its IUPAC name is 3-iodo-1,1-dipropylurea.
| Compound Name | 3-iodo-1,1-dipropylurea |
|---|---|
| PubChem CID | 87969845 |
| Molecular Formula | C7H15IN2O |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-iodo-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NI |
| InChI | InChI=1S/C7H15IN2O/c1-3-5-10(6-4-2)7(11)9-8/h3-6H2,1-2H3,(H,9,11) |
| InChIKey | QJDMFQVSVSVAKF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|