C11H22N2O — CID 108910720
3-[(E)-but-1-enyl]-1,1-dipropylurea (PubChem CID 108910720) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-1,1-dipropylurea.
| Compound Name | 3-[(E)-but-1-enyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 108910720 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 3-[(E)-but-1-enyl]-1,1-dipropylurea |
| SMILES | CC/C=C/NC(=O)N(CCC)CCC |
| InChI | InChI=1S/C11H22N2O/c1-4-7-8-12-11(14)13(9-5-2)10-6-3/h7-8H,4-6,9-10H2,1-3H3,(H,12,14)/b8-7+ |
| InChIKey | REKSYHPDOBUTEK-BQYQJAHWSA-N |
| XLogP | 2.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |