C10H19NO — CID 21329403
(E)-N,N-dipropylbut-2-enamide (PubChem CID 21329403) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (E)-N,N-dipropylbut-2-enamide.
| Compound Name | (E)-N,N-dipropylbut-2-enamide |
|---|---|
| PubChem CID | 21329403 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (E)-N,N-dipropylbut-2-enamide |
| SMILES | C/C=C/C(=O)N(CCC)CCC |
| InChI | InChI=1S/C10H19NO/c1-4-7-10(12)11(8-5-2)9-6-3/h4,7H,5-6,8-9H2,1-3H3/b7-4+ |
| InChIKey | MBCISOWSCPOAPY-QPJJXVBHSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|