C13H25NO — CID 154390041
N,N-dibutylpent-2-enamide (PubChem CID 154390041) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N,N-dibutylpent-2-enamide.
| Compound Name | N,N-dibutylpent-2-enamide |
|---|---|
| PubChem CID | 154390041 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N,N-dibutylpent-2-enamide |
| SMILES | CCC=CC(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C13H25NO/c1-4-7-10-13(15)14(11-8-5-2)12-9-6-3/h7,10H,4-6,8-9,11-12H2,1-3H3 |
| InChIKey | BNPOWUJWEMIKII-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|