About 2-oxo-N,N-dipentylacetamide
2-oxo-N,N-dipentylacetamide (PubChem CID 173270633) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-oxo-N,N-dipentylacetamide.
Molecular Properties
| Compound Name | 2-oxo-N,N-dipentylacetamide |
| PubChem CID | 173270633 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-oxo-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)C=O |
| InChI | InChI=1S/C12H23NO2/c1-3-5-7-9-13(12(15)11-14)10-8-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | RQCRDOUUWJVWND-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N,N-dipentylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N,N-dipentylacetamide?
The IUPAC name of 2-oxo-N,N-dipentylacetamide (CID 173270633) is 2-oxo-N,N-dipentylacetamide.
What is the SMILES notation for 2-oxo-N,N-dipentylacetamide?
The canonical SMILES for 2-oxo-N,N-dipentylacetamide is CCCCCN(CCCCC)C(=O)C=O.
What is the InChIKey of 2-oxo-N,N-dipentylacetamide?
The InChIKey is RQCRDOUUWJVWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-3-5-7-9-13(12(15)11-14)10-8-6-4-2/h11H,3-10H2,1-2H3.
What are the key properties of 2-oxo-N,N-dipentylacetamide?
2-oxo-N,N-dipentylacetamide has a molecular weight of 213.32 g/mol, XLogP of 2.39, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N,N-dipentylacetamide is sourced from PubChem (CID 173270633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).