C28H54N2O2 — CID 91739801
(E)-N,N,N',N'-tetrahexylbut-2-enediamide (PubChem CID 91739801) has the molecular formula C28H54N2O2 and a molecular weight of 450.75 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetrahexylbut-2-enediamide.
| Compound Name | (E)-N,N,N',N'-tetrahexylbut-2-enediamide |
|---|---|
| PubChem CID | 91739801 |
| Molecular Formula | C28H54N2O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | (E)-N,N,N',N'-tetrahexylbut-2-enediamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)/C=C/C(=O)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C28H54N2O2/c1-5-9-13-17-23-29(24-18-14-10-6-2)27(31)21-22-28(32)30(25-19-15-11-7-3)26-20-16-12-8-4/h21-22H,5-20,23-26H2,1-4H3/b22-21+ |
| InChIKey | HFXCWUPCGNFCIG-QURGRASLSA-N |
| XLogP | 7.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|