About 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide
3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide (PubChem CID 4626458) has the molecular formula C21H31Cl2NO
and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide |
| PubChem CID | 4626458 |
| Molecular Formula | C21H31Cl2NO |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H31Cl2NO/c1-3-5-7-9-16-24(17-10-8-6-4-2)21(25)15-14-18-19(22)12-11-13-20(18)23/h11-15H,3-10,16-17H2,1-2H3 |
| InChIKey | NUUIRVYAPHXUBC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide?
The IUPAC name of 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide (CID 4626458) is 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide?
The canonical SMILES for 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide is CCCCCCN(CCCCCC)C(=O)C=Cc1c(Cl)cccc1Cl.
What is the InChIKey of 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide?
The InChIKey is NUUIRVYAPHXUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31Cl2NO/c1-3-5-7-9-16-24(17-10-8-6-4-2)21(25)15-14-18-19(22)12-11-13-20(18)23/h11-15H,3-10,16-17H2,1-2H3.
What are the key properties of 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide?
3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide has a molecular weight of 384.39 g/mol, XLogP of 7.00, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide is sourced from PubChem (CID 4626458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).