C21H31Cl2NO — CID 4626458
3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide (PubChem CID 4626458) has the molecular formula C21H31Cl2NO and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide |
|---|---|
| PubChem CID | 4626458 |
| Molecular Formula | C21H31Cl2NO |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N,N-dihexylprop-2-enamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H31Cl2NO/c1-3-5-7-9-16-24(17-10-8-6-4-2)21(25)15-14-18-19(22)12-11-13-20(18)23/h11-15H,3-10,16-17H2,1-2H3 |
| InChIKey | NUUIRVYAPHXUBC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|