C21H34N2O — CID 11973969
(E)-3-(2-aminophenyl)-N,N-dihexylprop-2-enamide (PubChem CID 11973969) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is (E)-3-(2-aminophenyl)-N,N-dihexylprop-2-enamide.
| Compound Name | (E)-3-(2-aminophenyl)-N,N-dihexylprop-2-enamide |
|---|---|
| PubChem CID | 11973969 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | (E)-3-(2-aminophenyl)-N,N-dihexylprop-2-enamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)/C=C/c1ccccc1N |
| InChI | InChI=1S/C21H34N2O/c1-3-5-7-11-17-23(18-12-8-6-4-2)21(24)16-15-19-13-9-10-14-20(19)22/h9-10,13-16H,3-8,11-12,17-18,22H2,1-2H3/b16-15+ |
| InChIKey | PRHQEYKBDKXVGF-FOCLMDBBSA-N |
| XLogP | 5.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|