C18H17Cl2NO2 — CID 78854693
(E)-N-benzyl-3-(2,6-dichlorophenyl)-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 78854693) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is (E)-N-benzyl-3-(2,6-dichlorophenyl)-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(2,6-dichlorophenyl)-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78854693 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (E)-N-benzyl-3-(2,6-dichlorophenyl)-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C18H17Cl2NO2/c19-16-7-4-8-17(20)15(16)9-10-18(23)21(11-12-22)13-14-5-2-1-3-6-14/h1-10,22H,11-13H2/b10-9+ |
| InChIKey | RXSOJPPUEMLOBT-MDZDMXLPSA-N |
| XLogP | 4.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|