C21H33NO — CID 6163313
(E)-N,N-dibutyl-3-(4-tert-butylphenyl)prop-2-enamide (PubChem CID 6163313) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (E)-N,N-dibutyl-3-(4-tert-butylphenyl)prop-2-enamide.
| Compound Name | (E)-N,N-dibutyl-3-(4-tert-butylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6163313 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (E)-N,N-dibutyl-3-(4-tert-butylphenyl)prop-2-enamide |
| SMILES | CCCCN(CCCC)C(=O)/C=C/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO/c1-6-8-16-22(17-9-7-2)20(23)15-12-18-10-13-19(14-11-18)21(3,4)5/h10-15H,6-9,16-17H2,1-5H3/b15-12+ |
| InChIKey | KMQMBJYVGGIFDX-NTCAYCPXSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|