C19H25NO — CID 3616986
3-(4-tert-butylphenyl)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 3616986) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 3616986 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)C=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H25NO/c1-6-14-20(15-7-2)18(21)13-10-16-8-11-17(12-9-16)19(3,4)5/h6-13H,1-2,14-15H2,3-5H3 |
| InChIKey | KGQPLGAFFHCENM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|