C16H20N2O3S — CID 31245132
(E)-3-[4-(methanesulfonamido)phenyl]-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 31245132) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (E)-3-[4-(methanesulfonamido)phenyl]-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(methanesulfonamido)phenyl]-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 31245132 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (E)-3-[4-(methanesulfonamido)phenyl]-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C=C/c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-4-12-18(13-5-2)16(19)11-8-14-6-9-15(10-7-14)17-22(3,20)21/h4-11,17H,1-2,12-13H2,3H3/b11-8+ |
| InChIKey | OSJRACOQFDMEQU-DHZHZOJOSA-N |
| XLogP | 2.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|