C22H27Cl2N3O3S — CID 76870664
N-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 76870664) has the molecular formula C22H27Cl2N3O3S and a molecular weight of 484.45 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76870664 |
| Molecular Formula | C22H27Cl2N3O3S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CN(C)CCCN(Cc1ccc(Cl)c(Cl)c1)C(=O)C=Cc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H27Cl2N3O3S/c1-26(2)13-4-14-27(16-18-7-11-20(23)21(24)15-18)22(28)12-8-17-5-9-19(10-6-17)25-31(3,29)30/h5-12,15,25H,4,13-14,16H2,1-3H3 |
| InChIKey | UQRXKQNQFWNXKF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|