C19H20Cl2N2O2 — CID 72688526
3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide (PubChem CID 72688526) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 72688526 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
| SMILES | COCCCN(Cc1ccncc1)C(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-25-12-2-11-23(14-16-7-9-22-10-8-16)19(24)6-4-15-3-5-17(20)18(21)13-15/h3-10,13H,2,11-12,14H2,1H3 |
| InChIKey | NEIVBBHYMMNPSS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|