C14H14Cl2N2O — CID 134118071
(E)-N-(2-cyanoethyl)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide (PubChem CID 134118071) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is (E)-N-(2-cyanoethyl)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-N-(2-cyanoethyl)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 134118071 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (E)-N-(2-cyanoethyl)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide |
| SMILES | CCN(CCC#N)C(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O/c1-2-18(9-3-8-17)14(19)7-5-11-4-6-12(15)13(16)10-11/h4-7,10H,2-3,9H2,1H3/b7-5+ |
| InChIKey | KIESDAIFLYCKNA-FNORWQNLSA-N |
| XLogP | 3.77 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|