C15H14FN3O — CID 47148587
(E)-N,N-bis(2-cyanoethyl)-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 47148587) has the molecular formula C15H14FN3O and a molecular weight of 271.30 g/mol. Its IUPAC name is (E)-N,N-bis(2-cyanoethyl)-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N,N-bis(2-cyanoethyl)-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 47148587 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (E)-N,N-bis(2-cyanoethyl)-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | N#CCCN(CCC#N)C(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C15H14FN3O/c16-14-5-1-4-13(12-14)6-7-15(20)19(10-2-8-17)11-3-9-18/h1,4-7,12H,2-3,10-11H2/b7-6+ |
| InChIKey | WYTHOVQWCQICQE-VOTSOKGWSA-N |
| XLogP | 2.49 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|