C17H16BrN3O3 — CID 30398230
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 30398230) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 30398230 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | N#CCCN(CCC#N)C(=O)COC(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrN3O3/c18-15-5-1-4-14(12-15)6-7-17(23)24-13-16(22)21(10-2-8-19)11-3-9-20/h1,4-7,12H,2-3,10-11,13H2/b7-6+ |
| InChIKey | XNGZFILKDQZLLT-VOTSOKGWSA-N |
| XLogP | 2.66 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|