C15H15BrN2O3 — CID 7808427
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 7808427) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7808427 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | CN(CCC#N)C(=O)COC(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C15H15BrN2O3/c1-18(9-3-8-17)14(19)11-21-15(20)7-6-12-4-2-5-13(16)10-12/h2,4-7,10H,3,9,11H2,1H3/b7-6+ |
| InChIKey | YLRKWXHFPTZNCF-VOTSOKGWSA-N |
| XLogP | 2.38 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|