C25H30N2O4 — CID 9287411
[2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 9287411) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9287411 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)N(CCC#N)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-30-22-5-2-4-18(13-22)6-7-24(29)31-17-23(28)27(9-3-8-26)25-14-19-10-20(15-25)12-21(11-19)16-25/h2,4-7,13,19-21H,3,9-12,14-17H2,1H3/b7-6+ |
| InChIKey | RIIVCJKNWMAQNW-VOTSOKGWSA-N |
| XLogP | 3.96 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|