C26H35N3O2 — CID 8770729
N-(1-adamantyl)-N-(2-cyanoethyl)-2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]acetamide (PubChem CID 8770729) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-(1-adamantyl)-N-(2-cyanoethyl)-2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]acetamide.
| Compound Name | N-(1-adamantyl)-N-(2-cyanoethyl)-2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 8770729 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-(1-adamantyl)-N-(2-cyanoethyl)-2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]acetamide |
| SMILES | COc1ccc(CN(CC(=O)N(CCC#N)C23CC4CC(CC(C4)C2)C3)C2CC2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-31-24-7-3-19(4-8-24)17-28(23-5-6-23)18-25(30)29(10-2-9-27)26-14-20-11-21(15-26)13-22(12-20)16-26/h3-4,7-8,20-23H,2,5-6,10-18H2,1H3 |
| InChIKey | QIPRZDZETAPHKJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |